 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 502,6-Difluoroaniline |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-07-06 10:41 |
| |
 |
|
2,6-Difluoroaniline
| Category: |
Intermediates |
|
| CAS NO: |
5509-65-9 |
| EC NO: |
226-853-0 |
| Molecular Formula: |
C6H5F2N |
| Molecular Weight: |
129.1092 |
| Specification: |
|
| InChI: |
InChI:1S/C6H5F2N/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| Synonyms: |
2,6-Difluorobenzenamine;7-fluoro-1-benzothiophene-2-carboxylic acid; |
| Molecular Structure: |
 |
|
