 Click on the image to check the artwork |
|
| product: |
view count: 1642,6-Difluorobenzoic acid |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-11-16 16:56 |
| |
 |
|
2,6-Difluorobenzoic acid
| Category: |
Intermediates |
|
| CAS NO: |
385-00-2 |
| EC NO: |
206-856-3 |
| Molecular Formula: |
C7H3F2O2
|
| Molecular Weight: |
157.0949 |
| Specification: |
|
| InChI: |
InChI=1/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11)/p-1 |
| Synonyms: |
Difluorobenzoicacid;2,6-difluorobenzoate; |
| Molecular Structure: |
 |
|
