 Click on the image to check the artwork |
|
| product: |
view count: 742,6-Difluorobenzonitrile |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-10-21 00:40 |
| |
 |
|
2,6-Difluorobenzonitrile
| Category: |
Intermediates |
|
| CAS NO: |
1897-52-5 |
| EC NO: |
217-589-7 |
| Molecular Formula: |
C7H3F2N |
| Molecular Weight: |
139.1022 |
| Specification: |
|
| InChI: |
InChI=1/C7H3F2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| Synonyms: |
2,6-Difluorobenzonitril;2,6-Difluorobenzonitrole; |
| Molecular Structure: |
 |
|
